CAS 1261971-03-2

5-(2-Furanyl)-3-pyridinol

Description:

5-(2-Furanyl)-3-pyridinol is an organic compound characterized by its unique structure, which features a pyridine ring substituted with a furanyl group. This compound is classified as a heterocyclic aromatic compound due to the presence of nitrogen in the pyridine ring and oxygen in the furan ring. It exhibits properties typical of both furan and pyridine derivatives, including potential aromaticity and reactivity due to the presence of functional groups. The compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the presence of both heteroatoms (nitrogen and oxygen) can influence its interaction with other molecules, potentially leading to applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₉H₇NO₂

InChI: InChI=1S/C9H7NO2/c11-8-4-7(5-10-6-8)9-2-1-3-12-9/h1-6,11H

InChI key: InChIKey=RYPLINZCYTXXKU-UHFFFAOYSA-N

SMILES: OC1=CC(=CN=C1)C2=CC=CO2

Synonyms:

• 3-Pyridinol, 5-(2-furanyl)-
• 5-(2-Furanyl)-3-pyridinol