CAS 1261971-09-8

2,2′,4′-Trimethyl[1,1′-biphenyl]-3-carboxylic acid

Description:

2,2′,4′-Trimethyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of three methyl groups at the 2, 2′, and 4′ positions contributes to its hydrophobic nature and influences its solubility in organic solvents. The carboxylic acid functional group at the 3-position imparts acidic properties, allowing for potential interactions in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting thermal and chemical stability due to its aromatic structure, making it suitable for applications in materials science or as an intermediate in organic synthesis. Additionally, the specific arrangement of substituents can affect its reactivity and interaction with other molecules, which is crucial for its potential use in pharmaceuticals or agrochemicals. Overall, 2,2′,4′-Trimethyl[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with unique properties stemming from its structural features.

Formula: C₁₆H₁₆O₂

InChI: InChI=1S/C16H16O2/c1-10-7-8-13(11(2)9-10)14-5-4-6-15(12(14)3)16(17)18/h4-9H,1-3H3,(H,17,18)

InChI key: InChIKey=NBESNFBLRRAOJS-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1C(O)=O)C2=C(C)C=C(C)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2,2′,4′-trimethyl-
• 2,2′,4′-Trimethyl[1,1′-biphenyl]-3-carboxylic acid

3-(2,4-Dimethylphenyl)-2-methylbenzoic acid

CAS: 1261971-09-8

Formula: C₁₆H₁₆O₂

Molecular weight: 240.2970

Ref: IN-DA000SA7