
CAS 1261971-11-2
:3-(2-Hydroxyphenyl)-2(1H)-pyridinone
Description:
3-(2-Hydroxyphenyl)-2(1H)-pyridinone, also known by its CAS number 1261971-11-2, is an organic compound characterized by its unique structural features, which include a pyridinone ring and a hydroxyl-substituted phenyl group. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the hydroxyl group that can engage in hydrogen bonding. The pyridinone moiety contributes to its potential biological activity, as compounds with similar structures are often investigated for their pharmacological properties, including antioxidant and anti-inflammatory effects. Additionally, the compound may exhibit chelating properties due to the presence of the nitrogen and oxygen atoms, which can coordinate with metal ions. Its molecular structure allows for various interactions, making it a subject of interest in medicinal chemistry and materials science. Overall, 3-(2-Hydroxyphenyl)-2(1H)-pyridinone represents a versatile compound with potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c13-10-6-2-1-4-8(10)9-5-3-7-12-11(9)14/h1-7,13H,(H,12,14)
InChI key:InChIKey=SXTGSUUSUUSWEZ-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1)C=2C(=O)NC=CC2
Synonyms:- 2(1H)-Pyridinone, 3-(2-hydroxyphenyl)-
- 3-(2-Hydroxyphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.