CAS 1261971-13-4

3-(1,6-Dihydro-6-oxo-2-pyridinyl)benzonitrile

Description:

3-(1,6-Dihydro-6-oxo-2-pyridinyl)benzonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring fused with a benzene ring and a nitrile functional group. The presence of the 1,6-dihydro-6-oxo-2-pyridinyl moiety suggests that it may exhibit specific reactivity and biological activity, potentially making it of interest in medicinal chemistry. The compound's molecular framework indicates that it may possess both hydrophilic and hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, the nitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound's potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity. As with many organic compounds, its stability, reactivity, and biological activity would be influenced by factors such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₁₂H₈N₂O

InChI: InChI=1S/C12H8N2O/c13-8-9-3-1-4-10(7-9)11-5-2-6-12(15)14-11/h1-7H,(H,14,15)

InChI key: InChIKey=DWFOTQQKVAJKGZ-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C=CC1)C=2NC(=O)C=CC2

Synonyms:

• Benzonitrile, 3-(1,6-dihydro-6-oxo-2-pyridinyl)-
• 3-(1,6-Dihydro-6-oxo-2-pyridinyl)benzonitrile