CAS 1261971-50-9

2′,4′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol

Description:

2′,4′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and one fluorine atom substituted on the biphenyl framework, specifically at the 2′ and 4′ positions, along with a hydroxyl (-OH) group at the 3-position. The presence of these halogen substituents and the hydroxyl group contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit properties such as moderate solubility in organic solvents and potential bioactivity, which may be influenced by the electron-withdrawing effects of the halogens. Additionally, the specific arrangement of substituents can affect its physical properties, such as melting and boiling points, as well as its interaction with biological systems. As with many halogenated compounds, it is important to consider environmental and health implications associated with its use and disposal.

Formula: C₁₂H₇Cl₂FO

InChI: InChI=1S/C12H7Cl2FO/c13-8-2-3-9(10(14)6-8)7-1-4-11(15)12(16)5-7/h1-6,16H

InChI key: InChIKey=JLYFIUBUPGWTEY-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(O)=C(F)C=C2)C=CC(Cl)=C1

Synonyms:

• [1,1′-Biphenyl]-3-ol, 2′,4′-dichloro-4-fluoro-
• 2′,4′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol