CAS 1261971-54-3

2′,5′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol

Description:

2′,5′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and one fluorine atom substituted on the biphenyl framework, specifically at the 2′ and 5′ positions, while a hydroxyl group (-OH) is present at the 3-position. The presence of these halogen substituents and the hydroxyl group contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit interesting properties such as lipophilicity and potential biological activity. Additionally, the specific arrangement of substituents can influence its solubility, stability, and interaction with biological systems. As with many halogenated compounds, it is important to consider environmental and health implications associated with its use and disposal.

Formula: C₁₂H₇Cl₂FO

InChI: InChI=1S/C12H7Cl2FO/c13-8-2-3-10(14)9(6-8)7-1-4-11(15)12(16)5-7/h1-6,16H

InChI key: InChIKey=YYRLUHSYRQBNHZ-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(O)=C(F)C=C2)C=C(Cl)C=C1

Synonyms:

• 2′,5′-Dichloro-4-fluoro[1,1′-biphenyl]-3-ol
• [1,1′-Biphenyl]-3-ol, 2′,5′-dichloro-4-fluoro-