CAS 1261971-89-4

3′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The compound features a trifluoromethyl group (-CF3) and a fluoro group (-F) that contribute to its unique electronic properties and hydrophobic character. The methyl group (-CH3) adds to the steric bulk of the molecule, potentially influencing its reactivity and interactions with other substances. This compound may exhibit interesting biological activity due to its fluorinated substituents, which can enhance lipophilicity and metabolic stability. Its specific applications and behavior in various chemical environments would depend on its structural characteristics and the presence of functional groups, making it a subject of interest in fields such as medicinal chemistry and materials science.

Formula: C₁₅H₁₀F₄O₂

InChI: InChI=1S/C15H10F4O2/c1-8-12(3-2-4-13(8)16)9-5-10(14(20)21)7-11(6-9)15(17,18)19/h2-7H,1H3,(H,20,21)

InChI key: InChIKey=YNPDMIHFMRDEHR-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(C(F)(F)F)=CC(C(O)=O)=C2)C=CC=C1F

Synonyms:

• 3′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-fluoro-2′-methyl-5-(trifluoromethyl)-