
CAS 1261971-94-1
:5-(2-Methoxyphenyl)-3-pyridinol
Description:
5-(2-Methoxyphenyl)-3-pyridinol, identified by its CAS number 1261971-94-1, is an organic compound characterized by its pyridine and phenol functional groups. This compound features a pyridin-3-ol structure, where a methoxy-substituted phenyl group is attached to the 5-position of the pyridine ring. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit potential pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests the potential for hydrogen bonding due to the hydroxyl group, which can affect solubility and reactivity. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-donating nature of the methoxy group. Overall, 5-(2-Methoxyphenyl)-3-pyridinol is a compound of interest for further research, particularly in the context of drug development and organic synthesis.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c1-15-12-5-3-2-4-11(12)9-6-10(14)8-13-7-9/h2-8,14H,1H3
InChI key:InChIKey=JTXOTLRCDICHBZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C=2C=C(O)C=NC2
Synonyms:- 5-(2-Methoxyphenyl)-3-pyridinol
- 3-Pyridinol, 5-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.