CymitQuimica logo

CAS 1261971-95-2

:

4-[4-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid

Description:
4-[4-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261971-95-2, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a methylsulfonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. It is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the carboxylic acid functional group. The methylsulfonyl group can enhance the compound's solubility and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the presence of both the pyridine and phenyl rings suggests potential applications in pharmaceuticals, particularly as a building block for drug development or as a ligand in coordination chemistry. Its specific biological activity and applications would depend on further studies and characterization.
Formula:C13H11NO4S
InChI:InChI=1S/C13H11NO4S/c1-19(17,18)10-4-2-9(3-5-10)11-6-7-14-8-12(11)13(15)16/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=ODAZUHBVZAVTHV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CC=NC1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:
  • 4-[4-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 4-[4-(methylsulfonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.