CymitQuimica logo

CAS 1261972-05-7

:

4-(2-Chlorophenyl)-2(1H)-pyridinone

Description:
4-(2-Chlorophenyl)-2(1H)-pyridinone, identified by its CAS number 1261972-05-7, is a chemical compound characterized by its pyridinone structure, which features a pyridine ring fused with a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the chlorophenyl group. The chlorine atom on the phenyl ring can influence the compound's reactivity and solubility, making it of interest in medicinal chemistry and drug development. The presence of the pyridinone moiety may contribute to its ability to interact with biological targets, potentially serving as a scaffold for the design of pharmaceuticals. Additionally, the compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and the environment in which it is studied. Overall, 4-(2-Chlorophenyl)-2(1H)-pyridinone represents a versatile structure with implications in various chemical and biological applications.
Formula:C11H8ClNO
InChI:InChI=1S/C11H8ClNO/c12-10-4-2-1-3-9(10)8-5-6-13-11(14)7-8/h1-7H,(H,13,14)
InChI key:InChIKey=LKTUYHVIOMCNIP-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(=O)NC=C2)C=CC=C1
Synonyms:
  • 2(1H)-Pyridinone, 4-(2-chlorophenyl)-
  • 4-(2-Chlorophenyl)-2(1H)-pyridinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.