CAS 1261972-11-5

3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which features a carboxylic acid functional group and a sulfonamide moiety. The presence of a chlorine atom at the 3-position and a pyrrolidine ring attached via a sulfonyl group at the 4′ position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, while the biphenyl structure may impart hydrophobic characteristics. The sulfonyl group enhances the compound's potential for hydrogen bonding and may influence its reactivity and biological activity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific interactions and stability of this compound can be influenced by factors such as pH and temperature, making it relevant in various chemical and biological contexts.

Formula: C₁₇H₁₆ClNO₄S

InChI: InChI=1S/C17H16ClNO4S/c18-16-11-13(5-8-15(16)17(20)21)12-3-6-14(7-4-12)24(22,23)19-9-1-2-10-19/h3-8,11H,1-2,9-10H2,(H,20,21)

InChI key: InChIKey=PZBUIMOWVRPMNT-UHFFFAOYSA-N

SMILES: ClC=1C=C(C2=CC=C(S(=O)(=O)N3CCCC3)C=C2)C=CC1C(O)=O

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-4′-(1-pyrrolidinylsulfonyl)-
• 3-Chloro-4′-(1-pyrrolidinylsulfonyl)[1,1′-biphenyl]-4-carboxylic acid