CAS 1261972-40-0

N-[3-(1,2-Dihydro-2-oxo-3-pyridinyl)phenyl]acetamide

Description:

N-[3-(1,2-Dihydro-2-oxo-3-pyridinyl)phenyl]acetamide, with the CAS number 1261972-40-0, is a chemical compound that features a pyridine ring fused with a phenyl group, indicating its potential biological activity. This compound is characterized by the presence of an acetamide functional group, which contributes to its solubility and reactivity. The structure suggests that it may exhibit properties typical of both amides and heterocyclic compounds, potentially influencing its interactions in biological systems. It may be of interest in medicinal chemistry due to its structural motifs, which are often associated with pharmacological activity. The presence of the dihydropyridine moiety may also suggest potential applications in areas such as neuropharmacology or as a scaffold for drug development. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature reference for precise characterization. Overall, this compound represents a unique structure that could be explored for various chemical and biological applications.

Formula: C₁₃H₁₂N₂O₂

InChI: InChI=1S/C13H12N2O2/c1-9(16)15-11-5-2-4-10(8-11)12-6-3-7-14-13(12)17/h2-8H,1H3,(H,14,17)(H,15,16)

InChI key: InChIKey=MWJCDQPUNWBHGA-UHFFFAOYSA-N

SMILES: O=C1C(C2=CC(NC(C)=O)=CC=C2)=CC=CN1

Synonyms:

• N-[3-(1,2-Dihydro-2-oxo-3-pyridinyl)phenyl]acetamide
• Acetamide, N-[3-(1,2-dihydro-2-oxo-3-pyridinyl)phenyl]-