CAS 1261972-51-3

3,3′-Dichloro-4′-methoxy[1,1′-biphenyl]-4-ol

Description:

3,3′-Dichloro-4′-methoxy[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and a methoxy group attached to the biphenyl framework, contributing to its chemical reactivity and potential biological activity. The presence of the hydroxyl group (-OH) indicates that it is a phenolic compound, which can influence its solubility and interaction with biological systems. The dichloro substitution pattern suggests that it may exhibit unique electronic properties and potential applications in various fields, including pharmaceuticals and agrochemicals. Its molecular structure can lead to interesting interactions with enzymes or receptors, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors, which are important considerations for its use and potential toxicity. Overall, 3,3′-Dichloro-4′-methoxy[1,1′-biphenyl]-4-ol represents a complex chemical entity with diverse implications in research and application.

Formula: C₁₃H₁₀Cl₂O₂

InChI: InChI=1S/C13H10Cl2O2/c1-17-13-5-3-9(7-11(13)15)8-2-4-12(16)10(14)6-8/h2-7,16H,1H3

InChI key: InChIKey=NKJUAEUKLHGTMM-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1OC)C2=CC(Cl)=C(O)C=C2

Synonyms:

• 3,3′-Dichloro-4′-methoxy[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 3,3′-dichloro-4′-methoxy-