
CAS 1261972-89-7
:1,6-Dihydro-6-oxo-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
Description:
1,6-Dihydro-6-oxo-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. This substance features a carboxylic acid group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the phenylmethoxy group enhances its lipophilicity, potentially influencing its solubility and biological activity. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Additionally, the presence of the keto group and the dihydro configuration indicates potential for tautomeric forms, which can affect its reactivity and interaction with biological targets. Overall, this compound's unique structural features may contribute to its utility in various applications, including drug development and organic synthesis. Further studies would be necessary to fully elucidate its properties and potential uses in scientific and industrial contexts.
Formula:C19H15NO4
InChI:InChI=1S/C19H15NO4/c21-18-17(10-15(11-20-18)19(22)23)14-7-4-8-16(9-14)24-12-13-5-2-1-3-6-13/h1-11H,12H2,(H,20,21)(H,22,23)
InChI key:InChIKey=QULVJYMRIXYJSZ-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C2=CC(OCC3=CC=CC=C3)=CC=C2
Synonyms:- 3-Pyridinecarboxylic acid, 1,6-dihydro-6-oxo-5-[3-(phenylmethoxy)phenyl]-
- 1,6-Dihydro-6-oxo-5-[3-(phenylmethoxy)phenyl]-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.