CAS 1261972-91-1

5-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol

Description:

5-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 5-position and a methylsulfonyl group at the 3′-position contributes to its unique chemical properties. The hydroxyl (-OH) group at the 3-position enhances its polarity and solubility in polar solvents, making it a potential candidate for various chemical reactions and applications. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Additionally, the presence of the methylsulfonyl group can enhance its stability and reactivity. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the purity of the substance. Safety and handling precautions should be observed, as with any chemical, to mitigate potential hazards associated with its use.

Formula: C₁₃H₁₁ClO₃S

InChI: InChI=1S/C13H11ClO3S/c1-18(16,17)13-4-2-3-9(7-13)10-5-11(14)8-12(15)6-10/h2-8,15H,1H3

InChI key: InChIKey=LUKAKFDJQXOUST-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(O)C1)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-ol, 5-chloro-3′-(methylsulfonyl)-
• 5-Chloro-3′-(methylsulfonyl)[1,1′-biphenyl]-3-ol