CAS 1261973-40-3

5-[3-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid

Description:

5-[3-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261973-40-3, is a chemical compound characterized by its complex structure that includes a pyridine ring and a phenyl group substituted with a methylsulfonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in polar solvents and the ability to participate in various chemical reactions due to the presence of functional groups. The methylsulfonyl group can enhance the compound's polarity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the carboxylic acid functional group contributes to its acidity and potential reactivity, allowing for interactions with other chemical species. Overall, this compound may be explored for applications in pharmaceuticals or agrochemicals, where its unique structural features could impart specific biological or chemical properties.

Formula: C₁₃H₁₁NO₄S

InChI: InChI=1S/C13H11NO4S/c1-19(17,18)12-4-2-3-9(6-12)10-5-11(13(15)16)8-14-7-10/h2-8H,1H3,(H,15,16)

InChI key: InChIKey=UKNZELWCEQXNDA-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C=1C=C(C=CC1)C=2C=C(C(O)=O)C=NC2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-[3-(methylsulfonyl)phenyl]-
• 5-[3-(Methylsulfonyl)phenyl]-3-pyridinecarboxylic acid

5-(3-Methylsulfonylphenyl)nicotinic acid

CAS: 1261973-40-3

Formula: C₁₃H₁₁NO₄S

Molecular weight: 277.2957

Ref: IN-DA000S9Z