CymitQuimica logo

CAS 1261973-52-7

:

4′-Acetyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
4′-Acetyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an acetyl group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification or amidation. The trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structural features may contribute to its potential applications in materials science or as an intermediate in organic synthesis. Its unique combination of functional groups suggests that it may exhibit interesting electronic properties, which could be explored in the development of new materials or pharmaceuticals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C16H11F3O3
InChI:InChI=1S/C16H11F3O3/c1-9(20)10-2-4-11(5-3-10)12-6-13(15(21)22)8-14(7-12)16(17,18)19/h2-8H,1H3,(H,21,22)
InChI key:InChIKey=SYUQJVGUMHCUNN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-acetyl-5-(trifluoromethyl)-
  • 4′-Acetyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.