CAS 1261973-74-3

2′,3′-Dimethyl-3-nitro[1,1′-biphenyl]-4-ol

Description:

2′,3′-Dimethyl-3-nitro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 4-position of the biphenyl framework contributes to its classification as a phenolic compound, which often exhibits antioxidant properties. The nitro group (-NO2) at the 3-position and the two methyl groups (-CH3) at the 2′ and 3′ positions introduce additional functional diversity, influencing the compound's reactivity and solubility. This compound may exhibit various chemical behaviors, including potential electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry and materials science. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-9-4-3-5-12(10(9)2)11-6-7-14(16)13(8-11)15(17)18/h3-8,16H,1-2H3

InChI key: InChIKey=UTNBWQZLOBWMCU-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(N(=O)=O)=C(O)C=C2)C=CC=C1C

Synonyms:

• [1,1′-Biphenyl]-4-ol, 2′,3′-dimethyl-3-nitro-
• 2′,3′-Dimethyl-3-nitro[1,1′-biphenyl]-4-ol