CymitQuimica logo

CAS 1261974-08-6

:

5′-Cyano-2′,4-difluoro[1,1′-biphenyl]-2-carboxylic acid

Description:
5′-Cyano-2′,4-difluoro[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and two fluorine atoms at the 2' and 4' positions of the biphenyl moiety contributes to its unique reactivity and physical properties. The carboxylic acid functional group (-COOH) at the 2-position enhances its acidity and solubility in polar solvents. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing effects of the cyano and fluorine substituents, which can influence its behavior in various chemical reactions and applications, such as in organic synthesis or materials science. Additionally, the presence of multiple functional groups suggests potential for hydrogen bonding and interactions with other molecules, making it a candidate for further study in fields like medicinal chemistry or agrochemicals. Overall, its structural features suggest a compound with diverse applications and significant chemical reactivity.
Formula:C14H7F2NO2
InChI:InChI=1S/C14H7F2NO2/c15-9-2-3-10(12(6-9)14(18)19)11-5-8(7-17)1-4-13(11)16/h1-6H,(H,18,19)
InChI key:InChIKey=YLKRBZKZIROGTN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(F)=C1)C2=CC(C#N)=CC=C2F
Synonyms:
  • 5′-Cyano-2′,4-difluoro[1,1′-biphenyl]-2-carboxylic acid
  • [1,1′-Biphenyl]-2-carboxylic acid, 5′-cyano-2′,4-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.