
CAS 1261974-57-5
:5-Chloro-3′-nitro[1,1′-biphenyl]-3-carboxylic acid
Description:
5-Chloro-3′-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates its acidic properties, while the chloro (-Cl) and nitro (-NO2) substituents introduce significant reactivity and polarity to the molecule. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the biphenyl structure may contribute to hydrophobic interactions. The nitro group can enhance the compound's electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the chlorine atom may influence the compound's electronic properties and steric hindrance. Overall, 5-Chloro-3′-nitro[1,1′-biphenyl]-3-carboxylic acid is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, depending on its reactivity and biological activity.
Formula:C13H8ClNO4
InChI:InChI=1S/C13H8ClNO4/c14-11-5-9(4-10(6-11)13(16)17)8-2-1-3-12(7-8)15(18)19/h1-7H,(H,16,17)
InChI key:InChIKey=JEYIHZUGDLDGBP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1)C2=CC(C(O)=O)=CC(Cl)=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 5-chloro-3′-nitro-
- 5-Chloro-3′-nitro[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.