CAS 1261974-65-5

2-Chloro-5-(4-methoxyphenyl)-3-pyridinecarboxylic acid

Description:

2-Chloro-5-(4-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a carboxylic acid group and a chloro group, as well as a methoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The chloro substituent can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The methoxy group may enhance lipophilicity and affect the compound's pharmacokinetic properties. Additionally, the presence of multiple functional groups suggests potential for hydrogen bonding and other intermolecular interactions, which can be significant in biological systems. Overall, this compound may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and synthesis.

Formula: C₁₃H₁₀ClNO₃

InChI: InChI=1S/C13H10ClNO3/c1-18-10-4-2-8(3-5-10)9-6-11(13(16)17)12(14)15-7-9/h2-7H,1H3,(H,16,17)

InChI key: InChIKey=LWVHNRIOGPJDJB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN=C1Cl)C2=CC=C(OC)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 2-chloro-5-(4-methoxyphenyl)-
• 2-Chloro-5-(4-methoxyphenyl)-3-pyridinecarboxylic acid