
CAS 1261974-96-2
:2′-Fluoro-5-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile
Description:
2′-Fluoro-5-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2′ position and a hydroxy group at the 5 position contributes to its unique reactivity and potential biological activity. The methoxy group at the 3′ position enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. Additionally, the carbonitrile functional group at the 3 position introduces a polar character, which can participate in hydrogen bonding and affect the compound's overall polarity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior would depend on the context of its use, including potential interactions with biological targets or its role in synthetic pathways.
Formula:C14H10FNO2
InChI:InChI=1S/C14H10FNO2/c1-18-13-4-2-3-12(14(13)15)10-5-9(8-16)6-11(17)7-10/h2-7,17H,1H3
InChI key:InChIKey=GLCGBKRWIGLAAD-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1OC)C2=CC(C#N)=CC(O)=C2
Synonyms:- [1,1′-Biphenyl]-3-carbonitrile, 2′-fluoro-5-hydroxy-3′-methoxy-
- 2′-Fluoro-5-hydroxy-3′-methoxy[1,1′-biphenyl]-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.