CAS 1261975-42-1

3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol

Description:

3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms and a nitro group on the biphenyl framework contributes to its unique chemical properties. The hydroxyl (-OH) group at the 4-position enhances its polarity and solubility in polar solvents. This compound is typically used in research and may have applications in the synthesis of other chemical entities or as an intermediate in organic synthesis. Its chlorinated and nitro-substituted nature suggests potential biological activity, which may warrant further investigation in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing effects of the nitro and chloro groups, making it a subject of interest in both environmental chemistry and materials science. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₁₂H₇Cl₂NO₃

InChI: InChI=1S/C12H7Cl2NO3/c13-9-3-8(4-10(14)6-9)7-1-2-12(16)11(5-7)15(17)18/h1-6,16H

InChI key: InChIKey=LKYSZRXVXUEQSM-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=C(Cl)C1)C2=CC(N(=O)=O)=C(O)C=C2

Synonyms:

• 3′,5′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 3′,5′-dichloro-3-nitro-