CAS 1261976-06-0

5-(4-Fluoro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:

5-(4-Fluoro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its distinct chemical properties and potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the fluorine substitution may enhance lipophilicity and influence its interaction with biological targets. The diketone functionality in the pyridine ring suggests potential reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the compound may exhibit interesting pharmacological properties, warranting investigation for therapeutic uses. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of heterocyclic compounds with potential significance in drug development and chemical research.

Formula: C₁₃H₁₀FNO₃

InChI: InChI=1S/C13H10FNO3/c1-7-4-8(2-3-11(7)14)10-5-9(13(17)18)6-15-12(10)16/h2-6H,1H3,(H,15,16)(H,17,18)

InChI key: InChIKey=YPKZGEJDFWOYRO-UHFFFAOYSA-N

SMILES: O=C1C(=CC(C(O)=O)=CN1)C2=CC(C)=C(F)C=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-(4-fluoro-3-methylphenyl)-1,6-dihydro-6-oxo-
• 5-(4-Fluoro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid