
CAS 1261976-13-9
:5-Methoxy-2-(3-thienyl)benzoic acid
Description:
5-Methoxy-2-(3-thienyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group and a thienyl substituent. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and can influence its reactivity and interaction with biological systems. The thienyl group, derived from thiophene, introduces heteroatoms into the structure, potentially affecting the compound's electronic properties and reactivity. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical research. Additionally, its carboxylic acid functional group (-COOH) contributes to its acidity and can participate in hydrogen bonding, influencing its physical properties such as melting point and solubility in water. Overall, 5-Methoxy-2-(3-thienyl)benzoic acid is notable for its unique combination of functional groups, which may confer specific chemical behaviors and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H10O3S
InChI:InChI=1S/C12H10O3S/c1-15-9-2-3-10(8-4-5-16-7-8)11(6-9)12(13)14/h2-7H,1H3,(H,13,14)
InChI key:InChIKey=JJQKIKWATHOQGW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(OC)=C1)C=2C=CSC2
Synonyms:- Benzoic acid, 5-methoxy-2-(3-thienyl)-
- 5-Methoxy-2-(3-thienyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.