
CAS 1261978-00-0
:4′-Chloro-3′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Chloro-3′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a carboxylic acid group (-COOH), a cyano group (-CN), and halogen substituents (chlorine and fluorine). The presence of these groups contributes to its chemical reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The chlorine and fluorine atoms can influence the compound's electronic properties, while the cyano group may enhance its polarity and solubility in polar solvents. Additionally, the carboxylic acid group can participate in hydrogen bonding, affecting its interactions with other molecules. Overall, the unique combination of substituents in this compound suggests it may exhibit interesting biological or chemical properties, making it a subject of interest for further research and development.
Formula:C14H7ClFNO2
InChI:InChI=1S/C14H7ClFNO2/c15-13-2-1-8(3-11(13)7-17)9-4-10(14(18)19)6-12(16)5-9/h1-6H,(H,18,19)
InChI key:InChIKey=ARFUNWQYOVZGIJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(F)C1)C2=CC(C#N)=C(Cl)C=C2
Synonyms:- 4′-Chloro-3′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-chloro-3′-cyano-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.