CAS 1261978-10-2

2-Amino-5-(5-fluoro-2-methoxyphenyl)-3-pyridinecarboxylic acid

Description:

2-Amino-5-(5-fluoro-2-methoxyphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features an amino group and a methoxy group, contributing to its potential biological activity. The presence of a fluorine atom on the aromatic ring may enhance its lipophilicity and influence its interaction with biological targets. The molecular structure suggests that it could participate in hydrogen bonding due to the amino and carboxylic acid groups, which may affect its solubility and reactivity. Additionally, the compound may exhibit properties relevant to medicinal chemistry, potentially serving as a lead compound in drug development. Its specific characteristics, such as melting point, solubility, and spectral properties, would typically be determined through experimental methods. Overall, this compound's unique functional groups and structural features make it of interest in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₃H₁₁FN₂O₃

InChI: InChI=1S/C13H11FN2O3/c1-19-11-3-2-8(14)5-9(11)7-4-10(13(17)18)12(15)16-6-7/h2-6H,1H3,(H2,15,16)(H,17,18)

InChI key: InChIKey=SATJCRGYODMXTQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(F)C=C1)C=2C=C(C(O)=O)C(N)=NC2

Synonyms:

• 2-Amino-5-(5-fluoro-2-methoxyphenyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-amino-5-(5-fluoro-2-methoxyphenyl)-