
CAS 1261978-11-3
:5′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Description:
5′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a fluorine atom, a methyl group, and a trifluoromethyl group, along with a hydroxyl (-OH) functional group. This compound is notable for its potential applications in pharmaceuticals and agrochemicals, particularly due to the presence of the trifluoromethyl group, which can enhance lipophilicity and metabolic stability. The hydroxyl group contributes to its polarity, influencing solubility and reactivity. The presence of fluorine atoms often imparts unique electronic properties, making such compounds of interest in medicinal chemistry for developing new therapeutic agents. Additionally, the biphenyl structure can affect the compound's conformational flexibility and interactions with biological targets. Overall, the combination of these functional groups and structural features makes 5′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol a compound of significant interest in various chemical research fields.
Formula:C14H10F4O
InChI:InChI=1S/C14H10F4O/c1-8-2-3-11(15)7-13(8)9-4-10(14(16,17)18)6-12(19)5-9/h2-7,19H,1H3
InChI key:InChIKey=VYCOTFROTZLFNG-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(C(F)(F)F)=CC(O)=C2)C=C(F)C=C1
Synonyms:- 5′-Fluoro-2′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5′-fluoro-2′-methyl-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.