CymitQuimica logo

CAS 1261978-16-8

:

4′-Ethyl 3′,4-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate

Description:
4′-Ethyl 3′,4-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of ethyl and difluoro substituents on the biphenyl framework significantly influences its chemical properties, including its reactivity and solubility. The dicarboxylate functional groups indicate that the compound contains two carboxylate moieties, which can participate in various chemical reactions, such as esterification or acid-base reactions. The difluoro substituents enhance the compound's electron-withdrawing characteristics, potentially affecting its electronic properties and interactions with other molecules. This compound may exhibit interesting thermal and photophysical properties, making it of interest in materials science and organic synthesis. Additionally, its unique structure could lead to applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research and characterization. Overall, the compound's distinct features stem from its functional groups and substituents, which dictate its behavior in chemical environments.
Formula:C16H12F2O4
InChI:InChI=1S/C16H12F2O4/c1-2-22-16(21)12-5-3-9(7-14(12)18)11-6-4-10(17)8-13(11)15(19)20/h3-8H,2H2,1H3,(H,19,20)
InChI key:InChIKey=QJUNNTNGOIPNQB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(F)=C1)C2=CC(F)=C(C(OCC)=O)C=C2
Synonyms:
  • 4′-Ethyl 3′,4-difluoro[1,1′-biphenyl]-2,4′-dicarboxylate
  • [1,1′-Biphenyl]-2,4′-dicarboxylic acid, 3′,4-difluoro-, 4′-ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.