
CAS 1261979-42-3
:2-Methoxy-5-[3-[(methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
Description:
2-Methoxy-5-[3-[(methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. This substance features a methoxy group, a carboxylic acid, and an amide moiety, contributing to its potential as a bioactive molecule. The presence of the methylamino group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound's solubility and reactivity can be influenced by the functional groups, which may also affect its pharmacokinetic properties. Additionally, the arrangement of substituents on the aromatic rings can impact its electronic properties and overall stability. As with many organic compounds, the synthesis and characterization of this substance would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure and purity. Overall, this compound may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C15H14N2O4
InChI:InChI=1S/C15H14N2O4/c1-16-13(18)10-5-3-4-9(6-10)11-7-12(15(19)20)14(21-2)17-8-11/h3-8H,1-2H3,(H,16,18)(H,19,20)
InChI key:InChIKey=YGFVCXRLBKQPSR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC(C(NC)=O)=CC=C2
Synonyms:- 2-Methoxy-5-[3-[(methylamino)carbonyl]phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-methoxy-5-[3-[(methylamino)carbonyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.