CAS 1261979-66-1

3-Chloro-3′-cyano[1,1′-biphenyl]-2-carboxylic acid

Description:

3-Chloro-3′-cyano[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group and a cyano group at specific positions on the biphenyl framework contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid functional group indicates that the compound can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in different solvents. Additionally, the cyano group can enhance the compound's electronic properties, making it useful in materials science and organic synthesis. The compound's molecular structure suggests that it may exhibit interesting biological activities, although specific biological data would require further investigation. Overall, 3-Chloro-3′-cyano[1,1′-biphenyl]-2-carboxylic acid is a versatile compound with potential applications in various chemical and industrial processes.

Formula: C₁₄H₈ClNO₂

InChI: InChI=1S/C14H8ClNO2/c15-12-6-2-5-11(13(12)14(17)18)10-4-1-3-9(7-10)8-16/h1-7H,(H,17,18)

InChI key: InChIKey=UINNMSRRWZPKEN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC=C1Cl)C2=CC(C#N)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 3-chloro-3′-cyano-
• 3-Chloro-3′-cyano[1,1′-biphenyl]-2-carboxylic acid