
CAS 1261980-14-6
:5-[3-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone
Description:
5-[3-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone, identified by its CAS number 1261980-14-6, is a chemical compound characterized by its complex structure, which includes a pyrimidinone core and a sulfonyl-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the pyrrolidinyl group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Its molecular structure may confer specific reactivity patterns, stability under various conditions, and the ability to form hydrogen bonds, which are crucial for its interactions in biological systems. Additionally, the sulfonyl group can enhance the compound's polarity and solubility, impacting its distribution and absorption in biological contexts. Overall, this compound's unique features make it a candidate for further investigation in medicinal chemistry and drug development.
Formula:C14H15N3O3S
InChI:InChI=1S/C14H15N3O3S/c18-14-15-9-12(10-16-14)11-4-3-5-13(8-11)21(19,20)17-6-1-2-7-17/h3-5,8-10H,1-2,6-7H2,(H,15,16,18)
InChI key:InChIKey=LOTKUMFLEIMBGQ-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C(C=CC1)C2=CNC(=O)N=C2)N3CCCC3
Synonyms:- 2(1H)-Pyrimidinone, 5-[3-(1-pyrrolidinylsulfonyl)phenyl]-
- 5-[3-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.