CAS 1261980-26-0
:3′-Methyl 5-chloro[1,1′-biphenyl]-3,3′-dicarboxylate
Description:
3′-Methyl 5-chloro[1,1′-biphenyl]-3,3′-dicarboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 3′ position and a chlorine atom at the 5 position on one of the phenyl rings contributes to its unique chemical properties. This compound features two carboxylate ester groups at the 3 and 3′ positions, which can influence its reactivity and solubility in various solvents. The chlorine substituent may enhance the compound's stability and alter its electronic properties, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. Overall, 3′-Methyl 5-chloro[1,1′-biphenyl]-3,3′-dicarboxylate is a versatile compound with potential applications in synthetic chemistry and material science.
Formula:C15H11ClO4
InChI:InChI=1S/C15H11ClO4/c1-20-15(19)10-4-2-3-9(5-10)11-6-12(14(17)18)8-13(16)7-11/h2-8H,1H3,(H,17,18)
InChI key:InChIKey=GXLPVKRHDGYXBG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(Cl)C1)C2=CC(C(OC)=O)=CC=C2
Synonyms:- 3′-Methyl 5-chloro[1,1′-biphenyl]-3,3′-dicarboxylate
- [1,1′-Biphenyl]-3,3′-dicarboxylic acid, 5-chloro-, 3′-methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.