CAS 1261980-91-9

3-Fluoro-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

3-Fluoro-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic properties. The compound also features two methoxy groups (-OCH3) at the 3′ and 5′ positions, which can influence its solubility and reactivity, as well as its electronic properties due to the electron-donating nature of the methoxy groups. The fluorine atom at the 3-position introduces electronegativity, potentially affecting the compound's polarity and reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features. Its specific interactions, stability, and potential applications would depend on further studies and characterization.

Formula: C₁₅H₁₃FO₄

InChI: InChI=1S/C15H13FO4/c1-19-11-5-10(6-12(8-11)20-2)9-3-4-13(15(17)18)14(16)7-9/h3-8H,1-2H3,(H,17,18)

InChI key: InChIKey=UEAGNAKLMVQVES-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1)C2=CC(F)=C(C(O)=O)C=C2

Synonyms:

• 3-Fluoro-3′,5′-dimethoxy[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 3-fluoro-3′,5′-dimethoxy-

4-(3,5-Dimethoxyphenyl)-2-fluorobenzoic acid

CAS: 1261980-91-9

Formula: C₁₅H₁₃FO₄

Molecular weight: 276.2597

Ref: IN-DA000SAT