CAS 1261981-37-6

3′,4′-Dichloro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid

Description:

3′,4′-Dichloro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 3′ and 4′ positions on one of the phenyl rings contributes to its halogenated nature, while the hydroxyl (-OH) group at the 2-position and the carboxylic acid (-COOH) group at the 4-position enhance its polarity and potential for hydrogen bonding. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, making it soluble in polar solvents. Its chlorinated structure may also impart unique reactivity and stability characteristics, influencing its behavior in various chemical reactions. Additionally, the compound may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and biological activity. Overall, its structural features suggest a compound with significant potential for further study and application in various chemical contexts.

Formula: C₁₃H₈Cl₂O₃

InChI: InChI=1S/C13H8Cl2O3/c14-10-4-2-7(5-11(10)15)9-3-1-8(13(17)18)6-12(9)16/h1-6,16H,(H,17,18)

InChI key: InChIKey=CRWOMRQBITWGHP-UHFFFAOYSA-N

SMILES: OC1=C(C2=CC(Cl)=C(Cl)C=C2)C=CC(C(O)=O)=C1

Synonyms:

• 3′,4′-Dichloro-2-hydroxy[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 3′,4′-dichloro-2-hydroxy-