CAS 1261981-56-9

4-(3,4-Difluorophenyl)-2(1H)-pyridinone

Description:

4-(3,4-Difluorophenyl)-2(1H)-pyridinone, identified by its CAS number 1261981-56-9, is an organic compound characterized by its unique structure, which includes a pyridinone core substituted with a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridinone moiety. The difluorophenyl substituent can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. It may also exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. The presence of fluorine atoms often contributes to increased lipophilicity and metabolic stability, which are desirable traits in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its functional groups, making it a candidate for further research in pharmaceutical applications. Overall, 4-(3,4-Difluorophenyl)-2(1H)-pyridinone represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₁₁H₇F₂NO

InChI: InChI=1S/C11H7F2NO/c12-9-2-1-7(5-10(9)13)8-3-4-14-11(15)6-8/h1-6H,(H,14,15)

InChI key: InChIKey=SELVRWWAJJHLMD-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1F)C2=CC(=O)NC=C2

Synonyms:

• 2(1H)-Pyridinone, 4-(3,4-difluorophenyl)-
• 4-(3,4-Difluorophenyl)-2(1H)-pyridinone