
CAS 1261981-87-6
:3,4′-Difluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
Description:
3,4′-Difluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by the presence of two fluorine atoms, a hydroxyl group, and a carboxylic acid functional group attached to a biphenyl structure. The fluorine substituents are located at the 3 and 4 positions of one phenyl ring, while the hydroxyl group is positioned at the 3′ location of the adjacent phenyl ring, and the carboxylic acid group is at the 4 position of the same ring. This compound exhibits properties typical of aromatic compounds, including stability and potential for hydrogen bonding due to the hydroxyl and carboxylic acid groups. Its molecular structure suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis. The presence of fluorine can enhance lipophilicity and influence biological activity, making it of interest in medicinal chemistry. Additionally, the compound's solubility and reactivity can be affected by the functional groups present, which may also play a role in its potential applications.
Formula:C13H8F2O3
InChI:InChI=1S/C13H8F2O3/c14-10-4-2-8(6-12(10)16)7-1-3-9(13(17)18)11(15)5-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=DRMSBGMCXNKGJP-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C(O)=O)C2=CC(O)=C(F)C=C2
Synonyms:- 3,4′-Difluoro-3′-hydroxy[1,1′-biphenyl]-4-carboxylic acid
- [1,1′-Biphenyl]-4-carboxylic acid, 3,4′-difluoro-3′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.