
CAS 1261982-08-4
:2-[4-(Methylsulfonyl)phenyl]-3-pyridinol
Description:
2-[4-(Methylsulfonyl)phenyl]-3-pyridinol, identified by its CAS number 1261982-08-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a phenyl group substituted with a methylsulfonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity. The presence of the methylsulfonyl group may impart specific reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the pyridinol structure suggests potential for hydrogen bonding and coordination with metal ions, which can influence its chemical behavior and interactions. Overall, this compound's characteristics, including its molecular structure and functional groups, contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. Further studies would be necessary to elucidate its specific properties, reactivity, and potential uses in various chemical contexts.
Formula:C12H11NO3S
InChI:InChI=1S/C12H11NO3S/c1-17(15,16)10-6-4-9(5-7-10)12-11(14)3-2-8-13-12/h2-8,14H,1H3
InChI key:InChIKey=TUSTYBDVHRAHFT-UHFFFAOYSA-N
SMILES:OC1=C(N=CC=C1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:- 2-[4-(Methylsulfonyl)phenyl]-3-pyridinol
- 3-Pyridinol, 2-[4-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.