
CAS 1261982-42-6
:3′-Chloro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde
Description:
3′-Chloro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a hydroxy group at the 4′ position on one of the phenyl rings contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The aldehyde functional group at the 2-position enhances its reactivity, making it suitable for further chemical modifications. This compound may exhibit specific physical properties such as solubility in organic solvents and potential biological activity due to its functional groups. Its molecular structure suggests that it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chloro substituent, which may pose health risks.
Formula:C13H9ClO2
InChI:InChI=1S/C13H9ClO2/c14-12-7-9(5-6-13(12)16)11-4-2-1-3-10(11)8-15/h1-8,16H
InChI key:InChIKey=JVGQXKLDXABVPY-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)C2=CC(Cl)=C(O)C=C2
Synonyms:- 3′-Chloro-4′-hydroxy[1,1′-biphenyl]-2-carboxaldehyde
- [1,1′-Biphenyl]-2-carboxaldehyde, 3′-chloro-4′-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.