CymitQuimica logo

CAS 1261982-43-7

:

2-(2-Fluoro-5-methoxyphenyl)-4-pyridinecarboxylic acid

Description:
2-(2-Fluoro-5-methoxyphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261982-43-7, is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring and a substituted phenyl group. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding, influencing its solubility in various solvents. Additionally, the fluorine substitution may enhance lipophilicity and metabolic stability. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods such as NMR and mass spectrometry. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C13H10FNO3
InChI:InChI=1S/C13H10FNO3/c1-18-9-2-3-11(14)10(7-9)12-6-8(13(16)17)4-5-15-12/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=WWZWZOMAXMFNKU-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OC)=CC1)C2=CC(C(O)=O)=CC=N2
Synonyms:
  • 4-Pyridinecarboxylic acid, 2-(2-fluoro-5-methoxyphenyl)-
  • 2-(2-Fluoro-5-methoxyphenyl)-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.