CymitQuimica logo

CAS 1261982-72-2

:

3-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyridinone

Description:
3-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyridinone, identified by its CAS number 1261982-72-2, is a chemical compound characterized by its complex structure, which includes a pyridinone core and a sulfonamide moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the pyrrolidinyl and sulfonyl groups, which may influence its interaction with biological targets. The sulfonamide group is known for its ability to form hydrogen bonds, potentially enhancing its pharmacological properties. Additionally, the compound may display characteristics such as stability under standard laboratory conditions, although specific reactivity can depend on the functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its biological activity and safety profile.
Formula:C15H16N2O3S
InChI:InChI=1S/C15H16N2O3S/c18-15-14(4-3-9-16-15)12-5-7-13(8-6-12)21(19,20)17-10-1-2-11-17/h3-9H,1-2,10-11H2,(H,16,18)
InChI key:InChIKey=MUTJSYLSKKILLL-UHFFFAOYSA-N
SMILES:O=C1C(C2=CC=C(S(=O)(=O)N3CCCC3)C=C2)=CC=CN1
Synonyms:
  • 3-[4-(1-Pyrrolidinylsulfonyl)phenyl]-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 3-[4-(1-pyrrolidinylsulfonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.