
CAS 1261983-01-0
:4′-Methoxy-3′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Methoxy-3′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the para position and a methyl group (-CH3) at the meta position on one of the phenyl rings contributes to its unique chemical properties, including its solubility and reactivity. The trifluoromethyl group (-CF3) at the 5-position enhances the compound's lipophilicity and can influence its biological activity. The carboxylic acid functional group (-COOH) at the 3-position is significant for its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, due to the presence of multiple functional groups that can participate in chemical reactions.
Formula:C16H13F3O3
InChI:InChI=1S/C16H13F3O3/c1-9-5-10(3-4-14(9)22-2)11-6-12(15(20)21)8-13(7-11)16(17,18)19/h3-8H,1-2H3,(H,20,21)
InChI key:InChIKey=ORBRETCYOUSDQF-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C2=CC(C)=C(OC)C=C2
Synonyms:- 4′-Methoxy-3′-methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-methoxy-3′-methyl-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.