
CAS 1261983-28-1
:5-Chloro-3′-fluoro-4′-methoxy[1,1′-biphenyl]-3-ol
Description:
5-Chloro-3′-fluoro-4′-methoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxyl group (-OH) at the 3-position of the biphenyl framework contributes to its classification as a phenolic compound, potentially influencing its reactivity and solubility. The chlorine atom at the 5-position and the fluorine atom at the 3′-position introduce halogen substituents that can affect the compound's electronic properties and biological activity. Additionally, the methoxy group (-OCH3) at the 4′-position enhances its lipophilicity and may influence its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its specific applications and behavior in various chemical environments would depend on further studies, including its synthesis, stability, and potential interactions with other molecules.
Formula:C13H10ClFO2
InChI:InChI=1S/C13H10ClFO2/c1-17-13-3-2-8(6-12(13)15)9-4-10(14)7-11(16)5-9/h2-7,16H,1H3
InChI key:InChIKey=GJSUAEGPPINFJJ-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(O)C1)C2=CC(F)=C(OC)C=C2
Synonyms:- 5-Chloro-3′-fluoro-4′-methoxy[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-chloro-3′-fluoro-4′-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.