CymitQuimica logo

CAS 1261983-49-6

:

2′,4′,6′-Trifluoro-5-hydroxy[1,1′-biphenyl]-3-carbonitrile

Description:
2′,4′,6′-Trifluoro-5-hydroxy[1,1′-biphenyl]-3-carbonitrile is a chemical compound characterized by its unique structural features, including a biphenyl backbone substituted with trifluoro and hydroxy groups, as well as a carbonitrile functional group. The presence of trifluoro groups imparts significant electronegativity and can influence the compound's reactivity and solubility. The hydroxy group contributes to potential hydrogen bonding, which may affect its physical properties such as boiling point and solubility in polar solvents. The carbonitrile group introduces a polar functional group that can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting biological activities due to its structural characteristics, making it of interest in pharmaceutical and agrochemical research. Additionally, its stability and reactivity can be influenced by the electronic effects of the trifluoro substituents. Overall, 2′,4′,6′-Trifluoro-5-hydroxy[1,1′-biphenyl]-3-carbonitrile represents a complex molecule with potential applications in various fields of chemistry.
Formula:C13H6F3NO
InChI:InChI=1S/C13H6F3NO/c14-9-4-11(15)13(12(16)5-9)8-1-7(6-17)2-10(18)3-8/h1-5,18H
InChI key:InChIKey=WDOCZYYGFGCFNF-UHFFFAOYSA-N
SMILES:FC1=C(C(F)=CC(F)=C1)C2=CC(C#N)=CC(O)=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carbonitrile, 2′,4′,6′-trifluoro-5-hydroxy-
  • 2′,4′,6′-Trifluoro-5-hydroxy[1,1′-biphenyl]-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.