
CAS 1261983-95-2
:4-(5-Fluoro-2-methylphenyl)-3-pyridinecarboxylic acid
Description:
4-(5-Fluoro-2-methylphenyl)-3-pyridinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a fluorine atom and a methyl group on the phenyl ring contributes to its distinct chemical properties and potential biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the aromatic components may impart hydrophobic characteristics. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The fluorine substitution can enhance metabolic stability and influence the lipophilicity of the molecule, which is crucial for drug design. Additionally, the compound may participate in various chemical reactions typical of carboxylic acids, such as esterification or amidation. Overall, 4-(5-Fluoro-2-methylphenyl)-3-pyridinecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-8-2-3-9(14)6-11(8)10-4-5-15-7-12(10)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=ZMQUHJNNHYDSNF-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CC=NC1)C2=C(C)C=CC(F)=C2
Synonyms:- 3-Pyridinecarboxylic acid, 4-(5-fluoro-2-methylphenyl)-
- 4-(5-Fluoro-2-methylphenyl)-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.