CAS 1261984-19-3

5-Hydroxy-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carbonitrile

Description:

5-Hydroxy-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1261984-19-3, is a chemical compound characterized by its biphenyl structure, which features a hydroxyl group and a carbonitrile functional group. The presence of the phenylmethoxy group enhances its potential for various chemical interactions, making it of interest in organic synthesis and medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups attached to the biphenyl core. The hydroxyl group can participate in hydrogen bonding, potentially affecting its physical properties like boiling and melting points. Additionally, the carbonitrile group may contribute to the compound's polarity and reactivity, making it a candidate for further chemical modifications. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific data regarding its biological activity or industrial applications would require further investigation.

Formula: C₂₀H₁₅NO₂

InChI: InChI=1S/C20H15NO2/c21-13-16-10-17(12-18(22)11-16)19-8-4-5-9-20(19)23-14-15-6-2-1-3-7-15/h1-12,22H,14H2

InChI key: InChIKey=BGEWFSKZWSKSSN-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(C3=CC(C#N)=CC(O)=C3)C=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 5-hydroxy-2′-(phenylmethoxy)-
• 5-Hydroxy-2′-(phenylmethoxy)[1,1′-biphenyl]-3-carbonitrile