CymitQuimica logo

CAS 1261984-20-6

:

2′,3′-Difluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:
2′,3′-Difluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol is a fluorinated organic compound characterized by the presence of multiple fluorine atoms and a hydroxyl group attached to a biphenyl structure. The compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical interactions. The presence of the trifluoromethyl group (-CF3) and difluoro substituents (-F) significantly influences its electronic properties, making it a candidate for applications in pharmaceuticals, agrochemicals, and materials science. The hydroxyl group (-OH) contributes to its polarity, potentially affecting solubility and reactivity. Additionally, the fluorine atoms can enhance the compound's lipophilicity and metabolic stability, which are important factors in drug design. Overall, this compound's unique structural features and functional groups make it an interesting subject for further research in various chemical applications.
Formula:C13H7F5O
InChI:InChI=1S/C13H7F5O/c14-11-3-1-2-10(12(11)15)7-4-8(13(16,17)18)6-9(19)5-7/h1-6,19H
InChI key:InChIKey=PXSNRTFYSNAEPW-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(C(F)(F)F)=CC(O)=C2)C=CC=C1F
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 2′,3′-difluoro-5-(trifluoromethyl)-
  • 2′,3′-Difluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.