CymitQuimica logo

CAS 1261984-22-8

:

4-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid

Description:
4-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a hydroxyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may act as a ligand in coordination chemistry. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its solubility and reactivity. This compound may also display biological activity, making it of interest in pharmaceutical research. Its molecular interactions and potential applications can be explored further in fields such as medicinal chemistry and materials science. Overall, 4-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid represents a versatile structure with implications in various chemical and biological contexts.
Formula:C11H8O3S
InChI:InChI=1S/C11H8O3S/c12-9-3-1-2-7(4-9)8-5-10(11(13)14)15-6-8/h1-6,12H,(H,13,14)
InChI key:InChIKey=QTJTWTGQVMYRQR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CS1)C2=CC(O)=CC=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-(3-hydroxyphenyl)-
  • 4-(3-Hydroxyphenyl)-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.