
CAS 1261984-37-5
:4′-Chloro-3′-methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Description:
4′-Chloro-3′-methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a hydroxyl group (-OH) at the 3-position, a chloro group (-Cl) at the 4′ position, a methyl group (-CH3) at the 3′ position, and a trifluoromethoxy group (-O-CF3) at the 5-position. The presence of the trifluoromethoxy group imparts unique electronic properties, making it a potential candidate for various applications in pharmaceuticals or agrochemicals. The chlorine and methyl substituents can influence the compound's reactivity and solubility, while the hydroxyl group can participate in hydrogen bonding, affecting its physical properties. Overall, this compound's structural features suggest it may exhibit interesting biological activity, though specific studies would be necessary to elucidate its potential uses and mechanisms of action.
Formula:C14H10ClF3O2
InChI:InChI=1S/C14H10ClF3O2/c1-8-4-9(2-3-13(8)15)10-5-11(19)7-12(6-10)20-14(16,17)18/h2-7,19H,1H3
InChI key:InChIKey=CDELGRWNEWUQCX-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C(C=C(O)C1)C2=CC(C)=C(Cl)C=C2
Synonyms:- 4′-Chloro-3′-methyl-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 4′-chloro-3′-methyl-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.