CymitQuimica logo

CAS 1261984-41-1

:

2′,5′-Dichloro-2-methyl[1,1′-biphenyl]-4-carboxylic acid

Description:
2′,5′-Dichloro-2-methyl[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two chlorine atoms and a carboxylic acid functional group, contributing to its chemical reactivity and potential applications. The presence of chlorine substituents typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The carboxylic acid group provides acidic properties, allowing for potential interactions with bases and other nucleophiles. Additionally, the methyl group attached to the biphenyl framework can affect the steric and electronic properties of the molecule. Overall, the unique combination of functional groups and structural features makes 2′,5′-Dichloro-2-methyl[1,1′-biphenyl]-4-carboxylic acid a compound of interest for further study in chemical synthesis and application.
Formula:C14H10Cl2O2
InChI:InChI=1S/C14H10Cl2O2/c1-8-6-9(14(17)18)2-4-11(8)12-7-10(15)3-5-13(12)16/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=PPMPMXGZFLVNDO-UHFFFAOYSA-N
SMILES:ClC1=C(C=C(Cl)C=C1)C2=C(C)C=C(C(O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 2′,5′-dichloro-2-methyl-
  • 2′,5′-Dichloro-2-methyl[1,1′-biphenyl]-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.